C15H21FN4O3 — CID 94657166
N-[2-[[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]carbamoylamino]ethyl]-4-fluorobenzamide (PubChem CID 94657166) has the molecular formula C15H21FN4O3 and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[2-[[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]carbamoylamino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]carbamoylamino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94657166 |
| Molecular Formula | C15H21FN4O3 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[2-[[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]carbamoylamino]ethyl]-4-fluorobenzamide |
| SMILES | C[C@H](NC(=O)NCCNC(=O)c1ccc(F)cc1)C(=O)N(C)C |
| InChI | InChI=1S/C15H21FN4O3/c1-10(14(22)20(2)3)19-15(23)18-9-8-17-13(21)11-4-6-12(16)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,17,21)(H2,18,19,23)/t10-/m0/s1 |
| InChIKey | OGHVHBFTFITHCB-JTQLQIEISA-N |
| XLogP | 0.33 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|