C18H33N3O3 — CID 90715248
N-[(5S)-5,6-diamino-6-oxohexyl]benzamide;ethane;methoxyethane (PubChem CID 90715248) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(5S)-5,6-diamino-6-oxohexyl]benzamide;ethane;methoxyethane.
| Compound Name | N-[(5S)-5,6-diamino-6-oxohexyl]benzamide;ethane;methoxyethane |
|---|---|
| PubChem CID | 90715248 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | N-[(5S)-5,6-diamino-6-oxohexyl]benzamide;ethane;methoxyethane |
| SMILES | CC.CCOC.NC(=O)[C@@H](N)CCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19N3O2.C3H8O.C2H6/c14-11(12(15)17)8-4-5-9-16-13(18)10-6-2-1-3-7-10;1-3-4-2;1-2/h1-3,6-7,11H,4-5,8-9,14H2,(H2,15,17)(H,16,18);3H2,1-2H3;1-2H3/t11-;;/m0../s1 |
| InChIKey | RNNYPTGLRINEES-IDMXKUIJSA-N |
| XLogP | 2.08 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|