About 6-benzamidohexan-2-yl benzoate
6-benzamidohexan-2-yl benzoate (PubChem CID 67531968) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is 6-benzamidohexan-2-yl benzoate.
Molecular Properties
| Compound Name | 6-benzamidohexan-2-yl benzoate |
| PubChem CID | 67531968 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 6-benzamidohexan-2-yl benzoate |
| SMILES | CC(CCCCNC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO3/c1-16(24-20(23)18-13-6-3-7-14-18)10-8-9-15-21-19(22)17-11-4-2-5-12-17/h2-7,11-14,16H,8-10,15H2,1H3,(H,21,22) |
| InChIKey | MSMRCYBVLVAEEN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-benzamidohexan-2-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzamidohexan-2-yl benzoate?
The IUPAC name of 6-benzamidohexan-2-yl benzoate (CID 67531968) is 6-benzamidohexan-2-yl benzoate.
What is the SMILES notation for 6-benzamidohexan-2-yl benzoate?
The canonical SMILES for 6-benzamidohexan-2-yl benzoate is CC(CCCCNC(=O)c1ccccc1)OC(=O)c1ccccc1.
What is the InChIKey of 6-benzamidohexan-2-yl benzoate?
The InChIKey is MSMRCYBVLVAEEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-16(24-20(23)18-13-6-3-7-14-18)10-8-9-15-21-19(22)17-11-4-2-5-12-17/h2-7,11-14,16H,8-10,15H2,1H3,(H,21,22).
What are the key properties of 6-benzamidohexan-2-yl benzoate?
6-benzamidohexan-2-yl benzoate has a molecular weight of 325.41 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzamidohexan-2-yl benzoate is sourced from PubChem (CID 67531968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).