C26H28O3 — CID 139657190
7-[4-(4-hydroxyphenyl)phenyl]heptan-2-yl benzoate (PubChem CID 139657190) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 7-[4-(4-hydroxyphenyl)phenyl]heptan-2-yl benzoate.
| Compound Name | 7-[4-(4-hydroxyphenyl)phenyl]heptan-2-yl benzoate |
|---|---|
| PubChem CID | 139657190 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 7-[4-(4-hydroxyphenyl)phenyl]heptan-2-yl benzoate |
| SMILES | CC(CCCCCc1ccc(-c2ccc(O)cc2)cc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28O3/c1-20(29-26(28)24-10-6-3-7-11-24)8-4-2-5-9-21-12-14-22(15-13-21)23-16-18-25(27)19-17-23/h3,6-7,10-20,27H,2,4-5,8-9H2,1H3 |
| InChIKey | YQZMUAHSGYPZTB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|