6-phenylhexan-2-yl hydrogen carbonate

C13H18O3 — CID 67179658

IUPAC6-phenylhexan-2-yl hydrogen carbonate
SMILESCC(CCCCc1ccccc1)OC(=O)O
InChIInChI=1S/C13H18O3/c1-11(16-13(14)15)7-5-6-10-12-8-3-2-4-9-12/h2-4,8-9,11H,5-7,10H2,1H3,(H,14,15)
InChIKeyOIGBUESRAZRKGI-UHFFFAOYSA-N
MW222.28 g/mol
LogP3.48
Rot. Bonds6

About 6-phenylhexan-2-yl hydrogen carbonate

6-phenylhexan-2-yl hydrogen carbonate (PubChem CID 67179658) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 6-phenylhexan-2-yl hydrogen carbonate.

Molecular Properties

Compound Name6-phenylhexan-2-yl hydrogen carbonate
PubChem CID67179658
Molecular FormulaC13H18O3
Molecular Weight222.28 g/mol
Exact Mass222.13
IUPAC Name6-phenylhexan-2-yl hydrogen carbonate
SMILESCC(CCCCc1ccccc1)OC(=O)O
InChIInChI=1S/C13H18O3/c1-11(16-13(14)15)7-5-6-10-12-8-3-2-4-9-12/h2-4,8-9,11H,5-7,10H2,1H3,(H,14,15)
InChIKeyOIGBUESRAZRKGI-UHFFFAOYSA-N
XLogP3.48
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.28
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-phenylhexan-2-yl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-phenylhexan-2-yl hydrogen carbonate?
The IUPAC name of 6-phenylhexan-2-yl hydrogen carbonate (CID 67179658) is 6-phenylhexan-2-yl hydrogen carbonate.
What is the SMILES notation for 6-phenylhexan-2-yl hydrogen carbonate?
The canonical SMILES for 6-phenylhexan-2-yl hydrogen carbonate is CC(CCCCc1ccccc1)OC(=O)O.
What is the InChIKey of 6-phenylhexan-2-yl hydrogen carbonate?
The InChIKey is OIGBUESRAZRKGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-11(16-13(14)15)7-5-6-10-12-8-3-2-4-9-12/h2-4,8-9,11H,5-7,10H2,1H3,(H,14,15).
What are the key properties of 6-phenylhexan-2-yl hydrogen carbonate?
6-phenylhexan-2-yl hydrogen carbonate has a molecular weight of 222.28 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylhexan-2-yl hydrogen carbonate is sourced from PubChem (CID 67179658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).