About 6-phenylhexan-2-yl hydrogen carbonate
6-phenylhexan-2-yl hydrogen carbonate (PubChem CID 67179658) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 6-phenylhexan-2-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 6-phenylhexan-2-yl hydrogen carbonate |
| PubChem CID | 67179658 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 6-phenylhexan-2-yl hydrogen carbonate |
| SMILES | CC(CCCCc1ccccc1)OC(=O)O |
| InChI | InChI=1S/C13H18O3/c1-11(16-13(14)15)7-5-6-10-12-8-3-2-4-9-12/h2-4,8-9,11H,5-7,10H2,1H3,(H,14,15) |
| InChIKey | OIGBUESRAZRKGI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-phenylhexan-2-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylhexan-2-yl hydrogen carbonate?
The IUPAC name of 6-phenylhexan-2-yl hydrogen carbonate (CID 67179658) is 6-phenylhexan-2-yl hydrogen carbonate.
What is the SMILES notation for 6-phenylhexan-2-yl hydrogen carbonate?
The canonical SMILES for 6-phenylhexan-2-yl hydrogen carbonate is CC(CCCCc1ccccc1)OC(=O)O.
What is the InChIKey of 6-phenylhexan-2-yl hydrogen carbonate?
The InChIKey is OIGBUESRAZRKGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-11(16-13(14)15)7-5-6-10-12-8-3-2-4-9-12/h2-4,8-9,11H,5-7,10H2,1H3,(H,14,15).
What are the key properties of 6-phenylhexan-2-yl hydrogen carbonate?
6-phenylhexan-2-yl hydrogen carbonate has a molecular weight of 222.28 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylhexan-2-yl hydrogen carbonate is sourced from PubChem (CID 67179658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).