About 8-phenyloctan-2-yl nitrite
8-phenyloctan-2-yl nitrite (PubChem CID 161142900) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 8-phenyloctan-2-yl nitrite.
Molecular Properties
| Compound Name | 8-phenyloctan-2-yl nitrite |
| PubChem CID | 161142900 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 8-phenyloctan-2-yl nitrite |
| SMILES | CC(CCCCCCc1ccccc1)ON=O |
| InChI | InChI=1S/C14H21NO2/c1-13(17-15-16)9-5-2-3-6-10-14-11-7-4-8-12-14/h4,7-8,11-13H,2-3,5-6,9-10H2,1H3 |
| InChIKey | NSLVMZLBRGQPJK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-phenyloctan-2-yl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenyloctan-2-yl nitrite?
The IUPAC name of 8-phenyloctan-2-yl nitrite (CID 161142900) is 8-phenyloctan-2-yl nitrite.
What is the SMILES notation for 8-phenyloctan-2-yl nitrite?
The canonical SMILES for 8-phenyloctan-2-yl nitrite is CC(CCCCCCc1ccccc1)ON=O.
What is the InChIKey of 8-phenyloctan-2-yl nitrite?
The InChIKey is NSLVMZLBRGQPJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-13(17-15-16)9-5-2-3-6-10-14-11-7-4-8-12-14/h4,7-8,11-13H,2-3,5-6,9-10H2,1H3.
What are the key properties of 8-phenyloctan-2-yl nitrite?
8-phenyloctan-2-yl nitrite has a molecular weight of 235.33 g/mol, XLogP of 4.27, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenyloctan-2-yl nitrite is sourced from PubChem (CID 161142900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).