C21H36O2 — CID 139927269
15-phenylpentadecane-1,1-diol (PubChem CID 139927269) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 15-phenylpentadecane-1,1-diol.
| Compound Name | 15-phenylpentadecane-1,1-diol |
|---|---|
| PubChem CID | 139927269 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 15-phenylpentadecane-1,1-diol |
| SMILES | OC(O)CCCCCCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C21H36O2/c22-21(23)19-15-10-8-6-4-2-1-3-5-7-9-12-16-20-17-13-11-14-18-20/h11,13-14,17-18,21-23H,1-10,12,15-16,19H2 |
| InChIKey | CTBYWBQMBHMPRT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|