C32H38O4 — CID 139657287
8-[4-[4-(oxan-2-yloxy)phenyl]phenyl]octan-2-yl benzoate (PubChem CID 139657287) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is 8-[4-[4-(oxan-2-yloxy)phenyl]phenyl]octan-2-yl benzoate.
| Compound Name | 8-[4-[4-(oxan-2-yloxy)phenyl]phenyl]octan-2-yl benzoate |
|---|---|
| PubChem CID | 139657287 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 8-[4-[4-(oxan-2-yloxy)phenyl]phenyl]octan-2-yl benzoate |
| SMILES | CC(CCCCCCc1ccc(-c2ccc(OC3CCCCO3)cc2)cc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H38O4/c1-25(35-32(33)29-13-7-4-8-14-29)11-5-2-3-6-12-26-16-18-27(19-17-26)28-20-22-30(23-21-28)36-31-15-9-10-24-34-31/h4,7-8,13-14,16-23,25,31H,2-3,5-6,9-12,15,24H2,1H3 |
| InChIKey | LVVHRRIIHIXENL-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|