About 4-benzoyloxypentanoic acid;phenol
4-benzoyloxypentanoic acid;phenol (PubChem CID 175108201) has the molecular formula C18H20O5
and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-benzoyloxypentanoic acid;phenol.
Molecular Properties
| Compound Name | 4-benzoyloxypentanoic acid;phenol |
| PubChem CID | 175108201 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-benzoyloxypentanoic acid;phenol |
| SMILES | CC(CCC(=O)O)OC(=O)c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C12H14O4.C6H6O/c1-9(7-8-11(13)14)16-12(15)10-5-3-2-4-6-10;7-6-4-2-1-3-5-6/h2-6,9H,7-8H2,1H3,(H,13,14);1-5,7H |
| InChIKey | OJRZWNPZLHVRIQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzoyloxypentanoic acid;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyloxypentanoic acid;phenol?
The IUPAC name of 4-benzoyloxypentanoic acid;phenol (CID 175108201) is 4-benzoyloxypentanoic acid;phenol.
What is the SMILES notation for 4-benzoyloxypentanoic acid;phenol?
The canonical SMILES for 4-benzoyloxypentanoic acid;phenol is CC(CCC(=O)O)OC(=O)c1ccccc1.Oc1ccccc1.
What is the InChIKey of 4-benzoyloxypentanoic acid;phenol?
The InChIKey is OJRZWNPZLHVRIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4.C6H6O/c1-9(7-8-11(13)14)16-12(15)10-5-3-2-4-6-10;7-6-4-2-1-3-5-6/h2-6,9H,7-8H2,1H3,(H,13,14);1-5,7H.
What are the key properties of 4-benzoyloxypentanoic acid;phenol?
4-benzoyloxypentanoic acid;phenol has a molecular weight of 316.35 g/mol, XLogP of 3.49, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyloxypentanoic acid;phenol is sourced from PubChem (CID 175108201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).