About [(2S)-pentan-2-yl] benzoate
[(2S)-pentan-2-yl] benzoate (PubChem CID 101019298) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is [(2S)-pentan-2-yl] benzoate.
Molecular Properties
| Compound Name | [(2S)-pentan-2-yl] benzoate |
| PubChem CID | 101019298 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | [(2S)-pentan-2-yl] benzoate |
| SMILES | CCC[C@H](C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-3-7-10(2)14-12(13)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | COTNRKBHSLVYBC-JTQLQIEISA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-pentan-2-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-pentan-2-yl] benzoate?
The IUPAC name of [(2S)-pentan-2-yl] benzoate (CID 101019298) is [(2S)-pentan-2-yl] benzoate.
What is the SMILES notation for [(2S)-pentan-2-yl] benzoate?
The canonical SMILES for [(2S)-pentan-2-yl] benzoate is CCC[C@H](C)OC(=O)c1ccccc1.
What is the InChIKey of [(2S)-pentan-2-yl] benzoate?
The InChIKey is COTNRKBHSLVYBC-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16O2/c1-3-7-10(2)14-12(13)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3/t10-/m0/s1.
What are the key properties of [(2S)-pentan-2-yl] benzoate?
[(2S)-pentan-2-yl] benzoate has a molecular weight of 192.26 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-pentan-2-yl] benzoate is sourced from PubChem (CID 101019298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).