About 1-hydroxybutyl benzoate
1-hydroxybutyl benzoate (PubChem CID 23042733) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-hydroxybutyl benzoate.
Molecular Properties
| Compound Name | 1-hydroxybutyl benzoate |
| PubChem CID | 23042733 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-hydroxybutyl benzoate |
| SMILES | CCCC(O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-2-6-10(12)14-11(13)9-7-4-3-5-8-9/h3-5,7-8,10,12H,2,6H2,1H3 |
| InChIKey | TXBGWGCFHXRNPE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybutyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybutyl benzoate?
The IUPAC name of 1-hydroxybutyl benzoate (CID 23042733) is 1-hydroxybutyl benzoate.
What is the SMILES notation for 1-hydroxybutyl benzoate?
The canonical SMILES for 1-hydroxybutyl benzoate is CCCC(O)OC(=O)c1ccccc1.
What is the InChIKey of 1-hydroxybutyl benzoate?
The InChIKey is TXBGWGCFHXRNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-6-10(12)14-11(13)9-7-4-3-5-8-9/h3-5,7-8,10,12H,2,6H2,1H3.
What are the key properties of 1-hydroxybutyl benzoate?
1-hydroxybutyl benzoate has a molecular weight of 194.23 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybutyl benzoate is sourced from PubChem (CID 23042733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).