About octan-3-yl benzoate
octan-3-yl benzoate (PubChem CID 12820016) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is octan-3-yl benzoate.
Molecular Properties
| Compound Name | octan-3-yl benzoate |
| PubChem CID | 12820016 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | octan-3-yl benzoate |
| SMILES | CCCCCC(CC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O2/c1-3-5-7-12-14(4-2)17-15(16)13-10-8-6-9-11-13/h6,8-11,14H,3-5,7,12H2,1-2H3 |
| InChIKey | BMVPGSDZBWHZAT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-3-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-yl benzoate?
The IUPAC name of octan-3-yl benzoate (CID 12820016) is octan-3-yl benzoate.
What is the SMILES notation for octan-3-yl benzoate?
The canonical SMILES for octan-3-yl benzoate is CCCCCC(CC)OC(=O)c1ccccc1.
What is the InChIKey of octan-3-yl benzoate?
The InChIKey is BMVPGSDZBWHZAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-3-5-7-12-14(4-2)17-15(16)13-10-8-6-9-11-13/h6,8-11,14H,3-5,7,12H2,1-2H3.
What are the key properties of octan-3-yl benzoate?
octan-3-yl benzoate has a molecular weight of 234.34 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-yl benzoate is sourced from PubChem (CID 12820016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).