About 1-hydroxydecyl benzoate
1-hydroxydecyl benzoate (PubChem CID 54112556) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-hydroxydecyl benzoate.
Molecular Properties
| Compound Name | 1-hydroxydecyl benzoate |
| PubChem CID | 54112556 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-hydroxydecyl benzoate |
| SMILES | CCCCCCCCCC(O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O3/c1-2-3-4-5-6-7-11-14-16(18)20-17(19)15-12-9-8-10-13-15/h8-10,12-13,16,18H,2-7,11,14H2,1H3 |
| InChIKey | NICPURLYMGGNBQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxydecyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxydecyl benzoate?
The IUPAC name of 1-hydroxydecyl benzoate (CID 54112556) is 1-hydroxydecyl benzoate.
What is the SMILES notation for 1-hydroxydecyl benzoate?
The canonical SMILES for 1-hydroxydecyl benzoate is CCCCCCCCCC(O)OC(=O)c1ccccc1.
What is the InChIKey of 1-hydroxydecyl benzoate?
The InChIKey is NICPURLYMGGNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-2-3-4-5-6-7-11-14-16(18)20-17(19)15-12-9-8-10-13-15/h8-10,12-13,16,18H,2-7,11,14H2,1H3.
What are the key properties of 1-hydroxydecyl benzoate?
1-hydroxydecyl benzoate has a molecular weight of 278.39 g/mol, XLogP of 4.30, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxydecyl benzoate is sourced from PubChem (CID 54112556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).