C12H18O5 — CID 175588671
1,3-dihydroxypropyl benzoate;methoxymethane (PubChem CID 175588671) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1,3-dihydroxypropyl benzoate;methoxymethane.
| Compound Name | 1,3-dihydroxypropyl benzoate;methoxymethane |
|---|---|
| PubChem CID | 175588671 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1,3-dihydroxypropyl benzoate;methoxymethane |
| SMILES | COC.O=C(OC(O)CCO)c1ccccc1 |
| InChI | InChI=1S/C10H12O4.C2H6O/c11-7-6-9(12)14-10(13)8-4-2-1-3-5-8;1-3-2/h1-5,9,11-12H,6-7H2;1-2H3 |
| InChIKey | MXFUOWWVNGSSLH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|