C26H24O7 — CID 71606155
[(2S,3R)-2,3-dibenzoyloxy-5-hydroxypentyl] benzoate (PubChem CID 71606155) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is [(2S,3R)-2,3-dibenzoyloxy-5-hydroxypentyl] benzoate.
| Compound Name | [(2S,3R)-2,3-dibenzoyloxy-5-hydroxypentyl] benzoate |
|---|---|
| PubChem CID | 71606155 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(2S,3R)-2,3-dibenzoyloxy-5-hydroxypentyl] benzoate |
| SMILES | O=C(OC[C@H](OC(=O)c1ccccc1)[C@@H](CCO)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24O7/c27-17-16-22(32-25(29)20-12-6-2-7-13-20)23(33-26(30)21-14-8-3-9-15-21)18-31-24(28)19-10-4-1-5-11-19/h1-15,22-23,27H,16-18H2/t22-,23+/m1/s1 |
| InChIKey | VOHCQISNTFIMSW-PKTZIBPZSA-N |
| XLogP | 3.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|