C29H46N6O2 — CID 23400721
N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-4-phenylbenzamide (PubChem CID 23400721) has the molecular formula C29H46N6O2 and a molecular weight of 510.73 g/mol. Its IUPAC name is N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-4-phenylbenzamide.
| Compound Name | N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 23400721 |
| Molecular Formula | C29H46N6O2 |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-4-phenylbenzamide |
| SMILES | NCCCNCCCCNCCCNC(=O)C(N)CCCCNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H46N6O2/c30-17-8-20-32-18-6-7-19-33-21-9-23-35-29(37)27(31)12-4-5-22-34-28(36)26-15-13-25(14-16-26)24-10-2-1-3-11-24/h1-3,10-11,13-16,27,32-33H,4-9,12,17-23,30-31H2,(H,34,36)(H,35,37) |
| InChIKey | ZXAJBAHPOBNRDS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|