C47H56N6O8 — CID 11061840
methyl (2S)-2,6-bis[[(2S)-2,6-dibenzamidohexanoyl]amino]hexanoate (PubChem CID 11061840) has the molecular formula C47H56N6O8 and a molecular weight of 833.00 g/mol. Its IUPAC name is methyl (2S)-2,6-bis[[(2S)-2,6-dibenzamidohexanoyl]amino]hexanoate.
| Compound Name | methyl (2S)-2,6-bis[[(2S)-2,6-dibenzamidohexanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 11061840 |
| Molecular Formula | C47H56N6O8 |
| Molecular Weight | 833.00 g/mol |
| Exact Mass | 832.42 |
| IUPAC Name | methyl (2S)-2,6-bis[[(2S)-2,6-dibenzamidohexanoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)[C@H](CCCCNC(=O)c1ccccc1)NC(=O)c1ccccc1)NC(=O)[C@H](CCCCNC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C47H56N6O8/c1-61-47(60)40(53-46(59)39(52-44(57)37-26-12-5-13-27-37)29-15-18-32-49-42(55)35-22-8-3-9-23-35)30-16-19-33-50-45(58)38(51-43(56)36-24-10-4-11-25-36)28-14-17-31-48-41(54)34-20-6-2-7-21-34/h2-13,20-27,38-40H,14-19,28-33H2,1H3,(H,48,54)(H,49,55)(H,50,58)(H,51,56)(H,52,57)(H,53,59)/t38-,39-,40-/m0/s1 |
| InChIKey | KHZYTLTWPGGNER-MXVPUGLGSA-N |
| XLogP | 4.73 |
| TPSA | 200.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|