C14H21ClN4O3 — CID 133109165
methyl (2R)-2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride (PubChem CID 133109165) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl (2R)-2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride.
| Compound Name | methyl (2R)-2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 133109165 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl (2R)-2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](CCCN=C(N)N)NC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H20N4O3.ClH/c1-21-13(20)11(8-5-9-17-14(15)16)18-12(19)10-6-3-2-4-7-10;/h2-4,6-7,11H,5,8-9H2,1H3,(H,18,19)(H4,15,16,17);1H/t11-;/m1./s1 |
| InChIKey | MMZBVARFMVSTCT-RFVHGSKJSA-N |
| XLogP | 0.43 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|