C35H37N5O4 — CID 10281988
methyl 5-(diaminomethylideneamino)-2-[[3,3-diphenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]pentanoate (PubChem CID 10281988) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is methyl 5-(diaminomethylideneamino)-2-[[3,3-diphenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]pentanoate.
| Compound Name | methyl 5-(diaminomethylideneamino)-2-[[3,3-diphenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 10281988 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | methyl 5-(diaminomethylideneamino)-2-[[3,3-diphenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]pentanoate |
| SMILES | COC(=O)C(CCCN=C(N)N)NC(=O)C(NC(=O)c1ccc(-c2ccccc2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H37N5O4/c1-44-34(43)29(18-11-23-38-35(36)37)39-33(42)31(30(26-14-7-3-8-15-26)27-16-9-4-10-17-27)40-32(41)28-21-19-25(20-22-28)24-12-5-2-6-13-24/h2-10,12-17,19-22,29-31H,11,18,23H2,1H3,(H,39,42)(H,40,41)(H4,36,37,38) |
| InChIKey | XHWPDJXUXNVCMF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|