C32H34ClN5O4 — CID 70523890
naphthalen-1-yl (2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride (PubChem CID 70523890) has the molecular formula C32H34ClN5O4 and a molecular weight of 588.11 g/mol. Its IUPAC name is naphthalen-1-yl (2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride.
| Compound Name | naphthalen-1-yl (2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 70523890 |
| Molecular Formula | C32H34ClN5O4 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | naphthalen-1-yl (2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride |
| SMILES | Cl.NC(N)=NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C32H33N5O4.ClH/c33-32(34)35-20-10-18-26(31(40)41-28-19-9-16-23-13-7-8-17-25(23)28)36-30(39)27(21-22-11-3-1-4-12-22)37-29(38)24-14-5-2-6-15-24;/h1-9,11-17,19,26-27H,10,18,20-21H2,(H,36,39)(H,37,38)(H4,33,34,35);1H/t26-,27-;/m0./s1 |
| InChIKey | XGHYVLMZTKVQHD-WMXJXTQLSA-N |
| XLogP | 3.75 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|