C33H41N7O4 — CID 94864591
N-[(2R)-1-[[(2S)-1-[[(2S)-1-anilino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 94864591) has the molecular formula C33H41N7O4 and a molecular weight of 599.74 g/mol. Its IUPAC name is N-[(2R)-1-[[(2S)-1-[[(2S)-1-anilino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | N-[(2R)-1-[[(2S)-1-[[(2S)-1-anilino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 94864591 |
| Molecular Formula | C33H41N7O4 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | N-[(2R)-1-[[(2S)-1-[[(2S)-1-anilino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H41N7O4/c1-22(2)28(32(44)38-26(19-12-20-36-33(34)35)30(42)37-25-17-10-5-11-18-25)40-31(43)27(21-23-13-6-3-7-14-23)39-29(41)24-15-8-4-9-16-24/h3-11,13-18,22,26-28H,12,19-21H2,1-2H3,(H,37,42)(H,38,44)(H,39,41)(H,40,43)(H4,34,35,36)/t26-,27+,28-/m0/s1 |
| InChIKey | WFUSENHCPDYHMT-IARZGTGTSA-N |
| XLogP | 2.35 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|