C20H26N6O4 — CID 70542343
naphthalen-1-yl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 70542343) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is naphthalen-1-yl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | naphthalen-1-yl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 70542343 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | naphthalen-1-yl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | NCC(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H26N6O4/c21-11-17(27)25-12-18(28)26-15(8-4-10-24-20(22)23)19(29)30-16-9-3-6-13-5-1-2-7-14(13)16/h1-3,5-7,9,15H,4,8,10-12,21H2,(H,25,27)(H,26,28)(H4,22,23,24)/t15-/m0/s1 |
| InChIKey | KEDVUFLIWBMRAF-HNNXBMFYSA-N |
| XLogP | -0.64 |
| TPSA | 174.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|