C20H28Cl2N6O4 — CID 72943131
N-[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]-4-methoxynaphthalene-2-carboxamide;dihydrochloride (PubChem CID 72943131) has the molecular formula C20H28Cl2N6O4 and a molecular weight of 487.39 g/mol. Its IUPAC name is N-[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]-4-methoxynaphthalene-2-carboxamide;dihydrochloride.
| Compound Name | N-[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]-4-methoxynaphthalene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 72943131 |
| Molecular Formula | C20H28Cl2N6O4 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]-4-methoxynaphthalene-2-carboxamide;dihydrochloride |
| SMILES | COc1cc(C(=O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)cc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C20H26N6O4.2ClH/c1-30-16-10-13(9-12-5-2-3-6-14(12)16)18(28)26-19(29)15(25-17(27)11-21)7-4-8-24-20(22)23;;/h2-3,5-6,9-10,15H,4,7-8,11,21H2,1H3,(H,25,27)(H4,22,23,24)(H,26,28,29);2*1H/t15-;;/m0../s1 |
| InChIKey | XMBCFPSBCVJPGY-CKUXDGONSA-N |
| XLogP | 0.45 |
| TPSA | 174.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|