C24H25N5O3 — CID 67153684
N-[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]naphthalene-1-carboxamide (PubChem CID 67153684) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]naphthalene-1-carboxamide.
| Compound Name | N-[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 67153684 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]naphthalene-1-carboxamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccccc1)C(=O)NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H25N5O3/c25-24(26)27-15-7-14-20(28-21(30)17-9-2-1-3-10-17)23(32)29-22(31)19-13-6-11-16-8-4-5-12-18(16)19/h1-6,8-13,20H,7,14-15H2,(H,28,30)(H4,25,26,27)(H,29,31,32)/t20-/m0/s1 |
| InChIKey | HNMGLJWLQUXBNY-FQEVSTJZSA-N |
| XLogP | 1.95 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|