C13H18ClN5O2 — CID 71716214
N-[(2S)-1-amino-5-[[amino-(chloroamino)methylidene]amino]-1-oxopentan-2-yl]benzamide (PubChem CID 71716214) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-[(2S)-1-amino-5-[[amino-(chloroamino)methylidene]amino]-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-amino-5-[[amino-(chloroamino)methylidene]amino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 71716214 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[(2S)-1-amino-5-[[amino-(chloroamino)methylidene]amino]-1-oxopentan-2-yl]benzamide |
| SMILES | NC(=O)[C@H](CCC/N=C(\N)NCl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18ClN5O2/c14-19-13(16)17-8-4-7-10(11(15)20)18-12(21)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H2,15,20)(H,18,21)(H3,16,17,19)/t10-/m0/s1 |
| InChIKey | NCJCMRTVORBYQO-JTQLQIEISA-N |
| XLogP | 0.11 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|