C11H14N2O3 — CID 121216577
N-[(2S)-1-amino-4-hydroxy-1-oxobutan-2-yl]benzamide (PubChem CID 121216577) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 121216577 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-1-oxobutan-2-yl]benzamide |
| SMILES | NC(=O)[C@H](CCO)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O3/c12-10(15)9(6-7-14)13-11(16)8-4-2-1-3-5-8/h1-5,9,14H,6-7H2,(H2,12,15)(H,13,16)/t9-/m0/s1 |
| InChIKey | IGJUDJVYOCFQIB-VIFPVBQESA-N |
| XLogP | -0.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |