C11H13NO5 — CID 61243635
4-hydroxy-2-[(4-hydroxybenzoyl)amino]butanoic acid (PubChem CID 61243635) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-hydroxy-2-[(4-hydroxybenzoyl)amino]butanoic acid.
| Compound Name | 4-hydroxy-2-[(4-hydroxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 61243635 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 4-hydroxy-2-[(4-hydroxybenzoyl)amino]butanoic acid |
| SMILES | O=C(NC(CCO)C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H13NO5/c13-6-5-9(11(16)17)12-10(15)7-1-3-8(14)4-2-7/h1-4,9,13-14H,5-6H2,(H,12,15)(H,16,17) |
| InChIKey | IDCXXTWNFPWFHZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |