C15H21ClN4O2 — CID 166634442
N-[(2S)-1-amino-6-[(1-amino-2-chloroethylidene)amino]-1-oxohexan-2-yl]benzamide (PubChem CID 166634442) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is N-[(2S)-1-amino-6-[(1-amino-2-chloroethylidene)amino]-1-oxohexan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-amino-6-[(1-amino-2-chloroethylidene)amino]-1-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 166634442 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[(2S)-1-amino-6-[(1-amino-2-chloroethylidene)amino]-1-oxohexan-2-yl]benzamide |
| SMILES | NC(=O)[C@H](CCCC/N=C(/N)CCl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21ClN4O2/c16-10-13(17)19-9-5-4-8-12(14(18)21)20-15(22)11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H2,17,19)(H2,18,21)(H,20,22)/t12-/m0/s1 |
| InChIKey | LXHVEMWJSQIYGG-LBPRGKRZSA-N |
| XLogP | 1.04 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|