C32H40N6O5 — CID 13055268
naphthalen-1-yl 2-[2-[(2-benzamido-4-methylpentanoyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 13055268) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is naphthalen-1-yl 2-[2-[(2-benzamido-4-methylpentanoyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | naphthalen-1-yl 2-[2-[(2-benzamido-4-methylpentanoyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 13055268 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | naphthalen-1-yl 2-[2-[(2-benzamido-4-methylpentanoyl)amino]propanoylamino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)C(=O)NC(C)C(=O)NC(CCCN=C(N)N)C(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C32H40N6O5/c1-20(2)19-26(38-29(40)23-12-5-4-6-13-23)30(41)36-21(3)28(39)37-25(16-10-18-35-32(33)34)31(42)43-27-17-9-14-22-11-7-8-15-24(22)27/h4-9,11-15,17,20-21,25-26H,10,16,18-19H2,1-3H3,(H,36,41)(H,37,39)(H,38,40)(H4,33,34,35) |
| InChIKey | NXQMXPNCCPGOKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|