C27H32ClN5O4 — CID 70524230
naphthalen-1-yl (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride (PubChem CID 70524230) has the molecular formula C27H32ClN5O4 and a molecular weight of 526.04 g/mol. Its IUPAC name is naphthalen-1-yl (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride.
| Compound Name | naphthalen-1-yl (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 70524230 |
| Molecular Formula | C27H32ClN5O4 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | naphthalen-1-yl (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoate;hydrochloride |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)Oc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C27H31N5O4.ClH/c1-18(33)31-23(17-19-9-3-2-4-10-19)25(34)32-22(14-8-16-30-27(28)29)26(35)36-24-15-7-12-20-11-5-6-13-21(20)24;/h2-7,9-13,15,22-23H,8,14,16-17H2,1H3,(H,31,33)(H,32,34)(H4,28,29,30);1H/t22-,23-;/m0./s1 |
| InChIKey | CKFPJGLIIDHAEJ-SJEIDVEUSA-N |
| XLogP | 2.45 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|