C30H38FN9O3 — CID 11556145
N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-(naphthalen-1-ylmethylamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-4-fluorobenzamide (PubChem CID 11556145) has the molecular formula C30H38FN9O3 and a molecular weight of 591.69 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-(naphthalen-1-ylmethylamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-(naphthalen-1-ylmethylamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 11556145 |
| Molecular Formula | C30H38FN9O3 |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-5-(diaminomethylideneamino)-1-(naphthalen-1-ylmethylamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-4-fluorobenzamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccc(F)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H38FN9O3/c31-22-14-12-20(13-15-22)26(41)39-25(11-5-17-37-30(34)35)28(43)40-24(10-4-16-36-29(32)33)27(42)38-18-21-8-3-7-19-6-1-2-9-23(19)21/h1-3,6-9,12-15,24-25H,4-5,10-11,16-18H2,(H,38,42)(H,39,41)(H,40,43)(H4,32,33,36)(H4,34,35,37)/t24-,25-/m0/s1 |
| InChIKey | DIPZOOSTLXPHPB-DQEYMECFSA-N |
| XLogP | 0.99 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|