C40H44FN7O2 — CID 70685912
N-[(2S)-5-(diaminomethylideneamino)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]-4-[[(4-fluorophenyl)methyl-(2-pyridin-3-ylethyl)amino]methyl]benzamide (PubChem CID 70685912) has the molecular formula C40H44FN7O2 and a molecular weight of 673.84 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]-4-[[(4-fluorophenyl)methyl-(2-pyridin-3-ylethyl)amino]methyl]benzamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]-4-[[(4-fluorophenyl)methyl-(2-pyridin-3-ylethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 70685912 |
| Molecular Formula | C40H44FN7O2 |
| Molecular Weight | 673.84 g/mol |
| Exact Mass | 673.35 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]-4-[[(4-fluorophenyl)methyl-(2-pyridin-3-ylethyl)amino]methyl]benzamide |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccc(CN(CCc2cccnc2)Cc2ccc(F)cc2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C40H44FN7O2/c1-28(35-11-4-9-32-8-2-3-10-36(32)35)46-39(50)37(12-6-23-45-40(42)43)47-38(49)33-17-13-30(14-18-33)26-48(24-21-29-7-5-22-44-25-29)27-31-15-19-34(41)20-16-31/h2-5,7-11,13-20,22,25,28,37H,6,12,21,23-24,26-27H2,1H3,(H,46,50)(H,47,49)(H4,42,43,45)/t28-,37-/m0/s1 |
| InChIKey | UTUGYXULTQVXHB-AIJWEMPKSA-N |
| XLogP | 5.65 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|