C22H23FN2O — CID 55411329
2-[(4-fluorophenyl)methyl-methylamino]-N-(1-naphthalen-1-ylethyl)acetamide (PubChem CID 55411329) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-methylamino]-N-(1-naphthalen-1-ylethyl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-methylamino]-N-(1-naphthalen-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 55411329 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-methylamino]-N-(1-naphthalen-1-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN(C)Cc1ccc(F)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H23FN2O/c1-16(20-9-5-7-18-6-3-4-8-21(18)20)24-22(26)15-25(2)14-17-10-12-19(23)13-11-17/h3-13,16H,14-15H2,1-2H3,(H,24,26) |
| InChIKey | CZJYTCSGNQFSOO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |