C20H23FN2O3 — CID 94332991
3-pyridin-3-ylpropyl (2R)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 94332991) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl (2R)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | 3-pyridin-3-ylpropyl (2R)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 94332991 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-pyridin-3-ylpropyl (2R)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(F)cc1)C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C20H23FN2O3/c1-14(2)18(23-19(24)16-7-9-17(21)10-8-16)20(25)26-12-4-6-15-5-3-11-22-13-15/h3,5,7-11,13-14,18H,4,6,12H2,1-2H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | DXKICBSUAKFSCO-GOSISDBHSA-N |
| XLogP | 3.15 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|