C20H22N4O5 — CID 55939021
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 55939021) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 55939021 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccco1)C(=O)OCCCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C20H22N4O5/c1-13(2)17(23-19(25)15-7-4-10-27-15)20(26)28-11-5-8-16-22-18(24-29-16)14-6-3-9-21-12-14/h3-4,6-7,9-10,12-13,17H,5,8,11H2,1-2H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | HMLNESPPFXKAFE-KRWDZBQOSA-N |
| XLogP | 2.65 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|