C22H26N4O6S — CID 55939166
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55939166) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55939166 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)OCCCc2nc(-c3cccnc3)no2)C(C)C)cc1 |
| InChI | InChI=1S/C22H26N4O6S/c1-15(2)20(26-33(28,29)18-10-8-17(30-3)9-11-18)22(27)31-13-5-7-19-24-21(25-32-19)16-6-4-12-23-14-16/h4,6,8-12,14-15,20,26H,5,7,13H2,1-3H3/t20-/m0/s1 |
| InChIKey | XQNCKMPIRACYKZ-FQEVSTJZSA-N |
| XLogP | 2.62 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|