C23H22N4O5S — CID 55568006
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 55568006) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 55568006 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)OCCCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C23H22N4O5S/c28-22(31-14-4-8-21-26-23(27-32-21)19-7-3-12-24-16-19)11-13-25-33(29,30)20-10-9-17-5-1-2-6-18(17)15-20/h1-3,5-7,9-10,12,15-16,25H,4,8,11,13-14H2 |
| InChIKey | ATDDSAHUUTWNPK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|