C20H21N3O5 — CID 55568618
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 55568618) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 55568618 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCCCc2nc(-c3cccnc3)no2)cc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-25-16-8-7-14(11-17(16)26-2)12-19(24)27-10-4-6-18-22-20(23-28-18)15-5-3-9-21-13-15/h3,5,7-9,11,13H,4,6,10,12H2,1-2H3 |
| InChIKey | VVCRFVQHLFTFMJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|