C21H19N3O5 — CID 55567788
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 55567788) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 55567788 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCCCc3nc(-c4cccnc4)no3)coc2c1 |
| InChI | InChI=1S/C21H19N3O5/c1-26-16-6-7-17-15(13-28-18(17)11-16)10-20(25)27-9-3-5-19-23-21(24-29-19)14-4-2-8-22-12-14/h2,4,6-8,11-13H,3,5,9-10H2,1H3 |
| InChIKey | PBZMREHWBFIDGP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 100.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|