C27H22N4O6 — CID 55488353
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55488353) has the molecular formula C27H22N4O6 and a molecular weight of 498.50 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55488353 |
| Molecular Formula | C27H22N4O6 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)OCCCc4nc(-c5cccnc5)no4)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H22N4O6/c1-2-35-20-10-8-19(9-11-20)31-25(32)21-12-7-17(15-22(21)26(31)33)27(34)36-14-4-6-23-29-24(30-37-23)18-5-3-13-28-16-18/h3,5,7-13,15-16H,2,4,6,14H2,1H3 |
| InChIKey | SDAVYHDJVDSMRD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 124.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|