C28H22N2O7 — CID 24561943
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 24561943) has the molecular formula C28H22N2O7 and a molecular weight of 498.49 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 24561943 |
| Molecular Formula | C28H22N2O7 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)OCc4cc(-c5ccc(OC)cc5)no4)cc3C2=O)cc1 |
| InChI | InChI=1S/C28H22N2O7/c1-3-35-21-11-7-19(8-12-21)30-26(31)23-13-6-18(14-24(23)27(30)32)28(33)36-16-22-15-25(29-37-22)17-4-9-20(34-2)10-5-17/h4-15H,3,16H2,1-2H3 |
| InChIKey | VVWUICYKQFHVGB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|