C12H12N2O4 — CID 46892996
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl carbamate (PubChem CID 46892996) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl carbamate.
| Compound Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl carbamate |
|---|---|
| PubChem CID | 46892996 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl carbamate |
| SMILES | COc1ccc(-c2cc(COC(N)=O)on2)cc1 |
| InChI | InChI=1S/C12H12N2O4/c1-16-9-4-2-8(3-5-9)11-6-10(18-14-11)7-17-12(13)15/h2-6H,7H2,1H3,(H2,13,15) |
| InChIKey | MITIJDXKIHNGDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |