C22H22N2O6 — CID 92817363
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 92817363) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 92817363 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | COc1ccc(-c2cc(COC(=O)[C@H](C)N3C(=O)[C@H]4CC=CC[C@@H]4C3=O)on2)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-13(24-20(25)17-5-3-4-6-18(17)21(24)26)22(27)29-12-16-11-19(23-30-16)14-7-9-15(28-2)10-8-14/h3-4,7-11,13,17-18H,5-6,12H2,1-2H3/t13-,17-,18-/m0/s1 |
| InChIKey | PBGYQHGMQZGJIO-KKXDTOCCSA-N |
| XLogP | 2.73 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|