C20H19NO6 — CID 17482588
[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2,3-dimethoxybenzoate (PubChem CID 17482588) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2,3-dimethoxybenzoate.
| Compound Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 17482588 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl 2,3-dimethoxybenzoate |
| SMILES | COc1ccc(-c2cc(COC(=O)c3cccc(OC)c3OC)on2)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-23-14-9-7-13(8-10-14)17-11-15(27-21-17)12-26-20(22)16-5-4-6-18(24-2)19(16)25-3/h4-11H,12H2,1-3H3 |
| InChIKey | VVVQJGBTPWFVDL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |