C20H19NO5 — CID 30036377
(3-phenyl-1,2-oxazol-5-yl)methyl 3,5-dimethoxy-4-methylbenzoate (PubChem CID 30036377) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 3,5-dimethoxy-4-methylbenzoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3,5-dimethoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 30036377 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3,5-dimethoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(-c3ccccc3)no2)cc(OC)c1C |
| InChI | InChI=1S/C20H19NO5/c1-13-18(23-2)9-15(10-19(13)24-3)20(22)25-12-16-11-17(21-26-16)14-7-5-4-6-8-14/h4-11H,12H2,1-3H3 |
| InChIKey | WZZCKMJJSWOXMA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |