About (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate
(3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate (PubChem CID 130348153) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate |
| PubChem CID | 130348153 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate |
| SMILES | O=C(OCc1cc(-c2ccccc2)no1)C1=CC=CC1 |
| InChI | InChI=1S/C16H13NO3/c18-16(13-8-4-5-9-13)19-11-14-10-15(17-20-14)12-6-2-1-3-7-12/h1-8,10H,9,11H2 |
| InChIKey | UFBYQLLIHYHSEX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate?
The IUPAC name of (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate (CID 130348153) is (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate.
What is the SMILES notation for (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate?
The canonical SMILES for (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate is O=C(OCc1cc(-c2ccccc2)no1)C1=CC=CC1.
What is the InChIKey of (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate?
The InChIKey is UFBYQLLIHYHSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c18-16(13-8-4-5-9-13)19-11-14-10-15(17-20-14)12-6-2-1-3-7-12/h1-8,10H,9,11H2.
What are the key properties of (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate?
(3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate has a molecular weight of 267.28 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1,2-oxazol-5-yl)methyl cyclopenta-1,3-diene-1-carboxylate is sourced from PubChem (CID 130348153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).