C22H21NO5 — CID 37142164
(3-phenyl-1,2-oxazol-5-yl)methyl 4-[[(2S)-oxolan-2-yl]methoxy]benzoate (PubChem CID 37142164) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 4-[[(2S)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 37142164 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(OCc1cc(-c2ccccc2)no1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H21NO5/c24-22(17-8-10-18(11-9-17)26-14-19-7-4-12-25-19)27-15-20-13-21(23-28-20)16-5-2-1-3-6-16/h1-3,5-6,8-11,13,19H,4,7,12,14-15H2/t19-/m0/s1 |
| InChIKey | ADCPWIBMCZIATK-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |