C21H24O5 — CID 55323446
(2-ethoxyphenyl)methyl 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 55323446) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | (2-ethoxyphenyl)methyl 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 55323446 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2-ethoxyphenyl)methyl 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | CCOc1ccccc1COC(=O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H24O5/c1-2-23-20-8-4-3-6-17(20)14-26-21(22)16-9-11-18(12-10-16)25-15-19-7-5-13-24-19/h3-4,6,8-12,19H,2,5,7,13-15H2,1H3 |
| InChIKey | ZGRYTJCFYJTPQS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |