C24H24O6 — CID 7994556
(7-ethyl-2-oxochromen-4-yl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 7994556) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 7994556 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | CCc1ccc2c(COC(=O)c3ccc(OC[C@H]4CCCO4)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24O6/c1-2-16-5-10-21-18(13-23(25)30-22(21)12-16)14-29-24(26)17-6-8-19(9-7-17)28-15-20-4-3-11-27-20/h5-10,12-13,20H,2-4,11,14-15H2,1H3/t20-/m1/s1 |
| InChIKey | SEFWNDDESQPQKJ-HXUWFJFHSA-N |
| XLogP | 4.27 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|