C23H26O4 — CID 7867041
(7-ethyl-2-oxochromen-4-yl)methyl adamantane-1-carboxylate (PubChem CID 7867041) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl adamantane-1-carboxylate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7867041 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl adamantane-1-carboxylate |
| SMILES | CCc1ccc2c(COC(=O)C34CC5CC(CC(C5)C3)C4)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H26O4/c1-2-14-3-4-19-18(9-21(24)27-20(19)8-14)13-26-22(25)23-10-15-5-16(11-23)7-17(6-15)12-23/h3-4,8-9,15-17H,2,5-7,10-13H2,1H3 |
| InChIKey | FAUPTMFRGRERQQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|